EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 3H.C26H29NO.C6H5O7 |
| Net Charge | 0 |
| Average Mass | 563.647 |
| Monoisotopic Mass | 563.25192 |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[H+].[H+].[H+] |
| InChI | InChI=1S/C26H29NO.C6H8O7/c1-4-25(21-11-7-5-8-12-21)26(22-13-9-6-10-14-22)23-15-17-24(18-16-23)28-20-19-27(2)3;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-18H,4,19-20H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b26-25-; |
| InChIKey | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tamoxifen citrate (CHEBI:9397) has part tamoxifen (CHEBI:41774) |
| tamoxifen citrate (CHEBI:9397) has role angiogenesis inhibitor (CHEBI:48422) |
| tamoxifen citrate (CHEBI:9397) has role anticoronaviral agent (CHEBI:149553) |
| tamoxifen citrate (CHEBI:9397) is a citrate salt (CHEBI:50744) |
| IUPAC Name |
|---|
| 2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}-N,N-dimethylethanamine 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| Ethanamine, 2-(4-(1,2-diphenyl-1-butenyl)phenoxy)-N,N-dimethyl, (Z)-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) | ChemIDplus |
| (Z)-2-(p-(1,2-Diphenyl-1-butenyl)phenoxy)-N,N-dimethylethylamine citrate (1:1) | ChemIDplus |
| trans-1-(p-beta-Dimethylaminoethoxyphenyl)-1,2-diphenylbut-1-ene citrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Kessar | DrugBank |
| Nolvadex | DrugBank |
| Tamox | ChEBI |
| Tamoxan | ChEBI |
| Tamoxene | ChEBI |
| Tamoxin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5723042 | Beilstein |
| CAS:54965-24-1 | ChemIDplus |