EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10BrN3 |
| Net Charge | 0 |
| Average Mass | 264.126 |
| Monoisotopic Mass | 263.00581 |
| SMILES | C=CCNc1ncnc2ccc(Br)cc12 |
| InChI | InChI=1S/C11H10BrN3/c1-2-5-13-11-9-6-8(12)3-4-10(9)14-7-15-11/h2-4,6-7H,1,5H2,(H,13,14,15) |
| InChIKey | BCPOLXUSCUFDGE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SMER 28 (CHEBI:93943) has role autophagy inducer (CHEBI:138880) |
| SMER 28 (CHEBI:93943) is a organobromine compound (CHEBI:37141) |
| SMER 28 (CHEBI:93943) is a quinazolines (CHEBI:38530) |
| SMER 28 (CHEBI:93943) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 6-bromo-N-(prop-2-en-1-yl)quinazolin-4-amine |
| Synonyms | Source |
|---|---|
| 6-bromo-N-prop-2-enyl-4-quinazolinamine | ChEBI |
| SMER 28 | ChEBI |
| 6-bromo-N-2-propenyl-4-quinazolinamine | ChEBI |
| SMER-28 | ChEBI |
| 4-(allylamino)-6-bromoquinazoline | ChEBI |
| N-allyl-6-bromo-4-quinazolineamine | ChEBI |
| Citations |
|---|