EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO2 |
| Net Charge | 0 |
| Average Mass | 155.197 |
| Monoisotopic Mass | 155.09463 |
| SMILES | CN1C2CC(=O)CC1[C@H](O)C2 |
| InChI | InChI=1S/C8H13NO2/c1-9-5-2-6(10)4-7(9)8(11)3-5/h5,7-8,11H,2-4H2,1H3/t5?,7?,8-/m1/s1 |
| InChIKey | UOHSTKWPZWFYTF-TVZMIPGPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6R)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-one (CHEBI:93883) is a tropane alkaloid (CHEBI:37332) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4457 | LINCS |