EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | CNC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C12H14N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,13-14H,6H2,1H3,(H,15,16) |
| InChIKey | CZCIKBSVHDNIDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1H-indol-3-yl)-2-(methylamino)propanoic acid (CHEBI:93824) is a α-amino acid (CHEBI:33704) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4361 | LINCS |