EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO4 |
| Net Charge | 0 |
| Average Mass | 183.163 |
| Monoisotopic Mass | 183.05316 |
| SMILES | NC(C(=O)O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C8H9NO4/c9-7(8(12)13)4-1-5(10)3-6(11)2-4/h1-3,7,10-11H,9H2,(H,12,13) |
| InChIKey | HOOWCUZPEFNHDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-2-(3,5-dihydroxyphenyl)acetic acid (CHEBI:93822) is a α-amino acid (CHEBI:33704) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4358 | LINCS |