EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N3O3 |
| Net Charge | 0 |
| Average Mass | 335.363 |
| Monoisotopic Mass | 335.12699 |
| SMILES | O=C(C=Cc1ccccn1)NC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H17N3O3/c23-18(9-8-14-5-3-4-10-20-14)22-17(19(24)25)11-13-12-21-16-7-2-1-6-15(13)16/h1-10,12,17,21H,11H2,(H,22,23)(H,24,25) |
| InChIKey | UIMTZSFVAUUJNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1H-indol-3-yl)-2-[[1-oxo-3-(2-pyridinyl)prop-2-enyl]amino]propanoic acid (CHEBI:93801) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4325 | LINCS |