EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24NO4 |
| Net Charge | +1 |
| Average Mass | 318.393 |
| Monoisotopic Mass | 318.16998 |
| SMILES | C[N+]1(C)C2CC(OC(=O)[C@@H](CO)c3ccccc3)CC1C1OC12 |
| InChI | InChI=1S/C18H24NO4/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11/h3-7,12-17,20H,8-10H2,1-2H3/q+1/t12?,13-,14?,15?,16?,17?/m0/s1 |
| InChIKey | LZCOQTDXKCNBEE-RUTJIGONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-4308 (CHEBI:93791) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4308 | LINCS |