EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N4O4 |
| Net Charge | 0 |
| Average Mass | 282.300 |
| Monoisotopic Mass | 282.13281 |
| SMILES | C[C@H]([C@H](C)N1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C12H18N4O4/c1-7(15-3-9(17)13-10(18)4-15)8(2)16-5-11(19)14-12(20)6-16/h7-8H,3-6H2,1-2H3,(H,13,17,18)(H,14,19,20)/t7-,8+ |
| InChIKey | OBYGAPWKTPDTAS-OCAPTIKFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICRF-193 (CHEBI:93771) has role antineoplastic agent (CHEBI:35610) |
| ICRF-193 (CHEBI:93771) has role apoptosis inducer (CHEBI:68495) |
| ICRF-193 (CHEBI:93771) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| ICRF-193 (CHEBI:93771) is a N-alkylpiperazine (CHEBI:46845) |
| IUPAC Name |
|---|
| 4,4'-(2R,3S)-butane-2,3-diyldipiperazine-2,6-dione |
| Synonyms | Source |
|---|---|
| ICRF 193 | ChemIDplus |
| ICRF-193 | LINCS |
| meso-2,3-bis(2,6-dioxopiperazin-4-yl)butane | ChEBI |
| meso-4,4'-(1,2-dimethylethylene)di-2,6-piperazinedione | ChEBI |
| meso-4,4'-(3,2-butanediyl)-bis(2,6-piperazinedione) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:21416-88-6 | ChemIDplus |
| Citations |
|---|