EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N4O4 |
| Net Charge | 0 |
| Average Mass | 282.300 |
| Monoisotopic Mass | 282.13281 |
| SMILES | C[C@H]([C@H](C)N1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C12H18N4O4/c1-7(15-3-9(17)13-10(18)4-15)8(2)16-5-11(19)14-12(20)6-16/h7-8H,3-6H2,1-2H3,(H,13,17,18)(H,14,19,20)/t7-,8+ |
| InChIKey | OBYGAPWKTPDTAS-OCAPTIKFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICRF-193 (CHEBI:93771) has role antineoplastic agent (CHEBI:35610) |
| ICRF-193 (CHEBI:93771) has role apoptosis inducer (CHEBI:68495) |
| ICRF-193 (CHEBI:93771) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| ICRF-193 (CHEBI:93771) is a N-alkylpiperazine (CHEBI:46845) |
| IUPAC Name |
|---|
| 4,4'-(2R,3S)-butane-2,3-diyldipiperazine-2,6-dione |
| Synonyms | Source |
|---|---|
| ICRF 193 | ChemIDplus |
| ICRF-193 | LINCS |
| meso-2,3-bis(2,6-dioxopiperazin-4-yl)butane | ChEBI |
| meso-4,4'-(1,2-dimethylethylene)di-2,6-piperazinedione | ChEBI |
| meso-4,4'-(3,2-butanediyl)-bis(2,6-piperazinedione) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:21416-88-6 | ChemIDplus |
| Citations |
|---|