EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N8OS |
| Net Charge | 0 |
| Average Mass | 490.637 |
| Monoisotopic Mass | 490.22633 |
| SMILES | Cc1nc(Nc2nnc3c2CN(C(=O)N[C@H](CN(C)C)c2ccccc2)C3(C)C)c2sccc2n1 |
| InChI | InChI=1S/C25H30N8OS/c1-15-26-18-11-12-35-20(18)23(27-15)29-22-17-13-33(25(2,3)21(17)30-31-22)24(34)28-19(14-32(4)5)16-9-7-6-8-10-16/h6-12,19H,13-14H2,1-5H3,(H,28,34)(H2,26,27,29,30,31)/t19-/m1/s1 |
| InChIKey | AYCPARAPKDAOEN-LJQANCHMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-3758309 (CHEBI:93751) has role antineoplastic agent (CHEBI:35610) |
| PF-3758309 (CHEBI:93751) has role apoptosis inducer (CHEBI:68495) |
| PF-3758309 (CHEBI:93751) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| PF-3758309 (CHEBI:93751) is a benzenes (CHEBI:22712) |
| PF-3758309 (CHEBI:93751) is a pyrrolopyrazole (CHEBI:46866) |
| PF-3758309 (CHEBI:93751) is a secondary amino compound (CHEBI:50995) |
| PF-3758309 (CHEBI:93751) is a tertiary amino compound (CHEBI:50996) |
| PF-3758309 (CHEBI:93751) is a thienopyrimidine (CHEBI:143212) |
| PF-3758309 (CHEBI:93751) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methylthieno[3,2-d]pyrimidin-4-yl)amino]-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxamide |
| Synonyms | Source |
|---|---|
| PF-03758309 | ChEBI |
| PF 309 | ChEBI |
| PF-309 | ChEBI |
| PF309 | ChEBI |
| PF 3758309 | ChEBI |
| PF3758309 | ChEBI |
| Citations |
|---|