EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO6 |
| Net Charge | 0 |
| Average Mass | 399.443 |
| Monoisotopic Mass | 399.16819 |
| SMILES | COC1=C[C@@H]2C3=C([C@@H]2C1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c13 |
| InChI | InChI=1S/C22H25NO6/c1-10(24)23-13-7-6-11-8-15(27-3)21(28-4)22(29-5)16(11)17-12-9-14(26-2)20(25)18(12)19(13)17/h8-9,12-13,18H,6-7H2,1-5H3,(H,23,24)/t12-,13+,18-/m1/s1 |
| InChIKey | VKPVZFOUXUQJMW-FHSNZYRGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-4236 (CHEBI:93737) is a acetamides (CHEBI:22160) |
| LSM-4236 (CHEBI:93737) is a alkaloid (CHEBI:22315) |
| LSM-4236 (CHEBI:93737) is a carbotricyclic compound (CHEBI:38032) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4236 | LINCS |