EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O6 |
| Net Charge | 0 |
| Average Mass | 274.228 |
| Monoisotopic Mass | 274.04774 |
| SMILES | COc1cc(O)c2c(=O)c3c(O)c(O)ccc3oc2c1 |
| InChI | InChI=1S/C14H10O6/c1-19-6-4-8(16)11-10(5-6)20-9-3-2-7(15)13(17)12(9)14(11)18/h2-5,15-17H,1H3 |
| InChIKey | BDBVOZGRVBXANN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia decora (ncbitaxon:166616) | - | Article (Chemical studies on new xanthone from Swertia decora Zhongguo yao xue za zhi (Zhongguo yao xue hui : 1989) 36, 302-304) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| swertianin (CHEBI:9371) has role antioxidant (CHEBI:22586) |
| swertianin (CHEBI:9371) has role plant metabolite (CHEBI:76924) |
| swertianin (CHEBI:9371) is a aromatic ether (CHEBI:35618) |
| swertianin (CHEBI:9371) is a polyphenol (CHEBI:26195) |
| swertianin (CHEBI:9371) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| 2-O-methylswertianin (CHEBI:1228) has functional parent swertianin (CHEBI:9371) |
| IUPAC Name |
|---|
| 1,2,8-trihydroxy-6-methoxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| Swertianin | KEGG COMPOUND |
| 1,2,8-Trihydroxy-6-methoxyxanthone | KEGG COMPOUND |
| Gentiakochianin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1351024 | Reaxys |
| CAS:20882-75-1 | KEGG COMPOUND |
| CAS:20882-75-1 | ChemIDplus |
| Citations |
|---|