EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O7S |
| Net Charge | 0 |
| Average Mass | 427.479 |
| Monoisotopic Mass | 427.14132 |
| SMILES | CC(C)CN1CCN(C(=O)COC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H25N3O7S/c1-13(2)11-19-6-8-20(9-7-19)17(22)12-28-18(23)14-4-5-16(29(3,26)27)15(10-14)21(24)25/h4-5,10,13H,6-9,11-12H2,1-3H3 |
| InChIKey | UQEANGJNYLXOQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-4144 (CHEBI:93668) is a nitrobenzoic acid (CHEBI:25553) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4144 | LINCS |