EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9362 - suprofen
| Formula | C14H12O3S |
| Net Charge | 0 |
| Average Mass | 260.314 |
| Monoisotopic Mass | 260.05072 |
| SMILES | CC(C(=O)O)c1ccc(C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H12O3S/c1-9(14(16)17)10-4-6-11(7-5-10)13(15)12-3-2-8-18-12/h2-9H,1H3,(H,16,17) |
| InChIKey | MDKGKXOCJGEUJW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. drug allergen Any drug which causes the onset of an allergic reaction. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. drug allergen Any drug which causes the onset of an allergic reaction. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suprofen (CHEBI:9362) has role antirheumatic drug (CHEBI:35842) |
| suprofen (CHEBI:9362) has role drug allergen (CHEBI:88188) |
| suprofen (CHEBI:9362) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| suprofen (CHEBI:9362) has role non-narcotic analgesic (CHEBI:35481) |
| suprofen (CHEBI:9362) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| suprofen (CHEBI:9362) has role peripheral nervous system drug (CHEBI:49110) |
| suprofen (CHEBI:9362) is a aromatic ketone (CHEBI:76224) |
| suprofen (CHEBI:9362) is a monocarboxylic acid (CHEBI:25384) |
| suprofen (CHEBI:9362) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 2-[4-(thiophen-2-ylcarbonyl)phenyl]propanoic acid |
| INNs | Source |
|---|---|
| suprofene | ChemIDplus |
| suprofenum | ChemIDplus |
| suprofen | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-[4-(Thiophene-2-carbonyl)-phenyl]-propionic acid | ChEMBL |
| PROFENAL | ChEMBL |
| SUTOPROFEN | ChEMBL |
| p-2-thenoylhydratropic acid | ChemIDplus |
| 2-(4-(2-Thenoyl)phenyl)propionsäure | ChemIDplus |
| α-methyl-4-(2-thienylcarbonyl)benzeneacetic acid | ChemIDplus |
| Citations |
|---|