EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N4O4 |
| Net Charge | 0 |
| Average Mass | 404.511 |
| Monoisotopic Mass | 404.24236 |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)NC(=O)Nc2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H32N4O4/c1-6-29-18(26)15-11-13-25(14-12-15)19(27)21(2,3)23-20(28)22-16-7-9-17(10-8-16)24(4)5/h7-10,15H,6,11-14H2,1-5H3,(H2,22,23,28) |
| InChIKey | UHRURSJIJOASOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-[[[4-(dimethylamino)anilino]-oxomethyl]amino]-2-methyl-1-oxopropyl]-4-piperidinecarboxylic acid ethyl ester (CHEBI:93596) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4050 | LINCS |