EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N2O4S |
| Net Charge | 0 |
| Average Mass | 354.472 |
| Monoisotopic Mass | 354.16133 |
| SMILES | CCN1CCCC1CNC(=O)c1cc(S(=O)(=O)CC)ccc1OC |
| InChI | InChI=1S/C17H26N2O4S/c1-4-19-10-6-7-13(19)12-18-17(20)15-11-14(24(21,22)5-2)8-9-16(15)23-3/h8-9,11,13H,4-7,10,12H2,1-3H3,(H,18,20) |
| InChIKey | UNRHXEPDKXPRTM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sultopride (CHEBI:9356) has role antipsychotic agent (CHEBI:35476) |
| Sultopride (CHEBI:9356) is a organic molecular entity (CHEBI:50860) |
| Sultopride (CHEBI:9356) is a racemate (CHEBI:60911) |
| Sultopride (CHEBI:9356) is a salicylamides (CHEBI:53443) |
| INN | Source |
|---|---|
| sultoprida | WHO MedNet |
| Synonyms | Source |
|---|---|
| barnetil | DrugCentral |
| (+/-)-Sultopride | DrugCentral |
| Sultopride | KEGG COMPOUND |
| sultopride HCl | DrugCentral |
| sultopride hydrochloride | DrugCentral |
| Citations |
|---|