EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O4 |
| Net Charge | 0 |
| Average Mass | 401.507 |
| Monoisotopic Mass | 401.23146 |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)NC(=O)Nc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C22H31N3O4/c1-4-29-19(26)16-10-12-25(13-11-16)20(27)22(2,3)24-21(28)23-18-9-8-15-6-5-7-17(15)14-18/h8-9,14,16H,4-7,10-13H2,1-3H3,(H2,23,24,28) |
| InChIKey | JMTZZMQGTYZLPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-[[(2,3-dihydro-1H-inden-5-ylamino)-oxomethyl]amino]-2-methyl-1-oxopropyl]-4-piperidinecarboxylic acid ethyl ester (CHEBI:93499) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3920 | LINCS |