EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O4S |
| Net Charge | 0 |
| Average Mass | 244.272 |
| Monoisotopic Mass | 244.05178 |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H12N2O4S/c1-7-4-5-8(11(12)13)6-9(7)16(14,15)10(2)3/h4-6H,1-3H3 |
| InChIKey | IFIUFCJFLGCQPH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor that interferes with the action of a 3',5'-cyclic-AMP phosphodiesterase (EC 3.1.4.53). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BRL-50481 (CHEBI:93472) has role bone density conservation agent (CHEBI:50646) |
| BRL-50481 (CHEBI:93472) has role EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor (CHEBI:77758) |
| BRL-50481 (CHEBI:93472) has role geroprotector (CHEBI:176497) |
| BRL-50481 (CHEBI:93472) is a C-nitro compound (CHEBI:35716) |
| BRL-50481 (CHEBI:93472) is a sulfonamide (CHEBI:35358) |
| BRL-50481 (CHEBI:93472) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| N,N,2-trimethyl-5-nitrobenzenesulfonamide |
| Synonyms | Source |
|---|---|
| 3-(N,N-dimethylsulfonamido)-4-methyl-nitrobenzene | ChEBI |
| BRL 50481 | ChEBI |
| BRL50481 | ChEBI |
| N,N,2-trimethyl-5-nitrobenzene-1-sulfonamide | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:433695-36-4 | ChemIDplus |
| Citations |
|---|