EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O4S |
| Net Charge | 0 |
| Average Mass | 244.272 |
| Monoisotopic Mass | 244.05178 |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H12N2O4S/c1-7-4-5-8(11(12)13)6-9(7)16(14,15)10(2)3/h4-6H,1-3H3 |
| InChIKey | IFIUFCJFLGCQPH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor that interferes with the action of a 3',5'-cyclic-AMP phosphodiesterase (EC 3.1.4.53). |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BRL-50481 (CHEBI:93472) has role bone density conservation agent (CHEBI:50646) |
| BRL-50481 (CHEBI:93472) has role EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor (CHEBI:77758) |
| BRL-50481 (CHEBI:93472) has role geroprotector (CHEBI:176497) |
| BRL-50481 (CHEBI:93472) is a C-nitro compound (CHEBI:35716) |
| BRL-50481 (CHEBI:93472) is a sulfonamide (CHEBI:35358) |
| BRL-50481 (CHEBI:93472) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| N,N,2-trimethyl-5-nitrobenzenesulfonamide |
| Synonyms | Source |
|---|---|
| N,N,2-trimethyl-5-nitrobenzene-1-sulfonamide | IUPAC |
| BRL 50481 | ChEBI |
| BRL50481 | ChEBI |
| 3-(N,N-dimethylsulfonamido)-4-methyl-nitrobenzene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:433695-36-4 | ChemIDplus |
| Citations |
|---|