EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N2O3S |
| Net Charge | 0 |
| Average Mass | 404.491 |
| Monoisotopic Mass | 404.11946 |
| SMILES | O=C1C(CCS(=O)c2ccccc2)C(=O)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S/c26-22-21(16-17-29(28)20-14-8-3-9-15-20)23(27)25(19-12-6-2-7-13-19)24(22)18-10-4-1-5-11-18/h1-15,21H,16-17H2 |
| InChIKey | MBGGBVCUIVRRBF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfinpyrazone (CHEBI:9342) has role gout suppressant (CHEBI:35845) |
| sulfinpyrazone (CHEBI:9342) has role uricosuric drug (CHEBI:35841) |
| sulfinpyrazone (CHEBI:9342) is a pyrazolidines (CHEBI:38312) |
| sulfinpyrazone (CHEBI:9342) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 1,2-diphenyl-4-[2-(phenylsulfinyl)ethyl]pyrazolidine-3,5-dione |
| INN | Source |
|---|---|
| sulfinpirazona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,2-Diphenyl-3,5-dioxo-4-(2-phenylsulfinylethyl)pyrazolidine | ChemIDplus |
| 1,2-Diphenyl-4-(2'-phenylsulfinethyl)-3,5-pyrazolidinedione | ChemIDplus |
| 4-(2-Benzenesulfinylethyl)-1,2-diphenylpyrazolidine-3,5-dione | ChemIDplus |
| Anturane (TN) | KEGG DRUG |
| NSC-75925 | ChEMBL |
| Sulfinpyrazone | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Anturan | ChEMBL |
| Anturane | ChEMBL |
| Citations |
|---|