EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO |
| Net Charge | 0 |
| Average Mass | 283.415 |
| Monoisotopic Mass | 283.19361 |
| SMILES | CCN(CC)CCOc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H25NO/c1-3-20(4-2)14-15-21-19-12-10-18(11-13-19)16-17-8-6-5-7-9-17/h5-13H,3-4,14-16H2,1-2H3 |
| InChIKey | NFIXBCVWIPOYCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-diethyl-2-[4-(phenylmethyl)phenoxy]ethanamine (CHEBI:93414) has role antineoplastic agent (CHEBI:35610) |
| N,N-diethyl-2-[4-(phenylmethyl)phenoxy]ethanamine (CHEBI:93414) is a diarylmethane (CHEBI:51614) |
| INNs | Source |
|---|---|
| tesmilifene | WHO MedNet |
| tesmilifeno | WHO MedNet |
| Synonym | Source |
|---|---|
| tesmilifene | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-3805 | LINCS |
| Citations |
|---|