EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:93403 - 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1H-benzimidazol-2-one
| Formula | C22H24FN3O2 |
| Net Charge | 0 |
| Average Mass | 381.451 |
| Monoisotopic Mass | 381.18526 |
| SMILES | O=C(CCCN1CCC(n2c(=O)nc3ccccc32)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3O2/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28) |
| InChIKey | FEBOTPHFXYHVPL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1H-benzimidazol-2-one (CHEBI:93403) has role antidepressant (CHEBI:35469) |
| 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1H-benzimidazol-2-one (CHEBI:93403) has role antipsychotic agent (CHEBI:35476) |
| 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1H-benzimidazol-2-one (CHEBI:93403) has role anxiolytic drug (CHEBI:35474) |
| 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1H-benzimidazol-2-one (CHEBI:93403) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| benperidol | ChEMBL |
| Benperidol | ChEMBL |
| benzoperidol | DrugCentral |
| benzperidol | DrugCentral |
| frenactil | DrugCentral |
| frenactyl | DrugCentral |
| Brand Names | Source |
|---|---|
| Anquil | ChEMBL |
| Benquil | ChEMBL |
| Citations |
|---|