EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28ClN3O5 |
| Net Charge | 0 |
| Average Mass | 425.913 |
| Monoisotopic Mass | 425.17175 |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)NC(=O)Nc2ccc(OC)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H28ClN3O5/c1-5-29-17(25)13-8-10-24(11-9-13)18(26)20(2,3)23-19(27)22-14-6-7-16(28-4)15(21)12-14/h6-7,12-13H,5,8-11H2,1-4H3,(H2,22,23,27) |
| InChIKey | UPHKKUIXSHQDEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-[[(3-chloro-4-methoxyanilino)-oxomethyl]amino]-2-methyl-1-oxopropyl]-4-piperidinecarboxylic acid ethyl ester (CHEBI:93402) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3791 | LINCS |