EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N3O |
| Net Charge | 0 |
| Average Mass | 295.386 |
| Monoisotopic Mass | 295.16846 |
| SMILES | CN(C)CCN1C(=O)c2ccccc2N(C)c2ccccc21 |
| InChI | InChI=1S/C18H21N3O/c1-19(2)12-13-21-17-11-7-6-10-16(17)20(3)15-9-5-4-8-14(15)18(21)22/h4-11H,12-13H2,1-3H3 |
| InChIKey | QPGGEKPRGVJKQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[2-(dimethylamino)ethyl]-11-methyl-6-benzo[b][1,4]benzodiazepinone (CHEBI:93394) has role antidepressant (CHEBI:35469) |
| 5-[2-(dimethylamino)ethyl]-11-methyl-6-benzo[b][1,4]benzodiazepinone (CHEBI:93394) is a dibenzodiazepine (CHEBI:64051) |
| INN | Source |
|---|---|
| dibenzepina | WHO MedNet |
| Synonyms | Source |
|---|---|
| dibenzepin | ChEMBL |
| Dibenzepin | ChEMBL |
| dibenzepine | DrugCentral |
| dibenzepine HCl | DrugCentral |
| dibenzepine hydrochloride | DrugCentral |
| dibenzepin HCl | DrugCentral |
| Citations |
|---|