EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10Cl2F2N4O3S |
| Net Charge | 0 |
| Average Mass | 387.195 |
| Monoisotopic Mass | 385.98187 |
| SMILES | Cc1nn(-c2cc(NS(C)(=O)=O)c(Cl)cc2Cl)c(=O)n1C(F)F |
| InChI | InChI=1S/C11H10Cl2F2N4O3S/c1-5-16-19(11(20)18(5)10(14)15)9-4-8(17-23(2,21)22)6(12)3-7(9)13/h3-4,10,17H,1-2H3 |
| InChIKey | OORLZFUTLGXMEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfentrazone (CHEBI:9339) has role agrochemical (CHEBI:33286) |
| sulfentrazone (CHEBI:9339) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| sulfentrazone (CHEBI:9339) has role herbicide (CHEBI:24527) |
| sulfentrazone (CHEBI:9339) is a dichlorobenzene (CHEBI:23697) |
| sulfentrazone (CHEBI:9339) is a organofluorine compound (CHEBI:37143) |
| sulfentrazone (CHEBI:9339) is a sulfonamide (CHEBI:35358) |
| sulfentrazone (CHEBI:9339) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| N-{2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]phenyl}methanesulfonamide |
| Synonyms | Source |
|---|---|
| F6285 | KEGG COMPOUND |
| 2',4'-dichloro-5'-(4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl)methanesulfonanilide | Alan Wood's Pesticides |
| N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]methanesulfonamide | Alan Wood's Pesticides |
| F 6285 | ChemIDplus |
| FMC-97285 | ChEBI |
| Brand Name | Source |
|---|---|
| Authority | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11125 | KEGG COMPOUND |
| sulfentrazone | Alan Wood's Pesticides |
| US4818275 | Patent |
| HMDB0034852 | HMDB |
| 601 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8015123 | Reaxys |
| CAS:122836-35-5 | KEGG COMPOUND |
| CAS:122836-35-5 | Alan Wood's Pesticides |
| CAS:122836-35-5 | ChemIDplus |
| Citations |
|---|