EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H31F2N3O |
| Net Charge | 0 |
| Average Mass | 475.583 |
| Monoisotopic Mass | 475.24352 |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(CCCC(c1ccc(F)cc1)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C29H31F2N3O/c30-24-12-8-22(9-13-24)27(23-10-14-25(31)15-11-23)7-4-18-33-19-16-29(17-20-33)28(35)32-21-34(29)26-5-2-1-3-6-26/h1-3,5-6,8-15,27H,4,7,16-21H2,(H,32,35) |
| InChIKey | QOYHHIBFXOOADH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-[4,4-bis(4-fluorophenyl)butyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CHEBI:93369) has role antidepressant (CHEBI:35469) |
| 8-[4,4-bis(4-fluorophenyl)butyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CHEBI:93369) has role antipsychotic agent (CHEBI:35476) |
| 8-[4,4-bis(4-fluorophenyl)butyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CHEBI:93369) has role anxiolytic drug (CHEBI:35474) |
| 8-[4,4-bis(4-fluorophenyl)butyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CHEBI:93369) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| fluspirileno | WHO MedNet |
| Synonyms | Source |
|---|---|
| fluspirilen | DrugCentral |
| fluspirilene | ChEMBL |
| Fluspirilene | ChEMBL |
| fluspiriline | DrugCentral |
| MCN-JR-6218 | ChEMBL |
| R 6218 | DrugCentral |
| Brand Name | Source |
|---|---|
| Imap | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1222 | DrugCentral |
| HMDB0015590 | HMDB |
| LSM-3748 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1841-19-6 | DrugCentral |
| Citations |
|---|