EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO3 |
| Net Charge | 0 |
| Average Mass | 309.365 |
| Monoisotopic Mass | 309.13649 |
| SMILES | Cc1ccc(C)c(OCCn2cc(C(=O)O)c3ccccc32)c1 |
| InChI | InChI=1S/C19H19NO3/c1-13-7-8-14(2)18(11-13)23-10-9-20-12-16(19(21)22)15-5-3-4-6-17(15)20/h3-8,11-12H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | LILIWWFBJKBUCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-(2,5-dimethylphenoxy)ethyl]-3-indolecarboxylic acid (CHEBI:93345) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3713 | LINCS |