EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O2S2 |
| Net Charge | 0 |
| Average Mass | 270.339 |
| Monoisotopic Mass | 270.02452 |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 |
| InChI | InChI=1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
| InChIKey | VACCAVUAMIDAGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethizole (CHEBI:9331) has role antiinfective agent (CHEBI:35441) |
| sulfamethizole (CHEBI:9331) has role antimicrobial agent (CHEBI:33281) |
| sulfamethizole (CHEBI:9331) has role drug allergen (CHEBI:88188) |
| sulfamethizole (CHEBI:9331) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfamethizole (CHEBI:9331) is a sulfonamide (CHEBI:35358) |
| sulfamethizole (CHEBI:9331) is a sulfonamide antibiotic (CHEBI:87228) |
| sulfamethizole (CHEBI:9331) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfamethizole | ChemIDplus |
| sulfaméthizol | ChEBI |
| sulfamethizolum | ChemIDplus |
| sulfametizol | ChemIDplus |
| Synonyms | Source |
|---|---|
| Sulfamethizole | KEGG COMPOUND |
| sulfamethylthiadiazole | ChEBI |
| sulphamethiozole | ChEBI |
| sulphamethazole | ChEBI |
| Brand Name | Source |
|---|---|
| Rufol | DrugBank |
| Citations |
|---|