EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O2S2 |
| Net Charge | 0 |
| Average Mass | 270.339 |
| Monoisotopic Mass | 270.02452 |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 |
| InChI | InChI=1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
| InChIKey | VACCAVUAMIDAGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. drug allergen Any drug which causes the onset of an allergic reaction. EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethizole (CHEBI:9331) has role antibacterial agent (CHEBI:33282) |
| sulfamethizole (CHEBI:9331) has role antiinfective agent (CHEBI:35441) |
| sulfamethizole (CHEBI:9331) has role antimicrobial agent (CHEBI:33281) |
| sulfamethizole (CHEBI:9331) has role drug allergen (CHEBI:88188) |
| sulfamethizole (CHEBI:9331) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfamethizole (CHEBI:9331) has role ophthalmology drug (CHEBI:66981) |
| sulfamethizole (CHEBI:9331) is a sulfonamide (CHEBI:35358) |
| sulfamethizole (CHEBI:9331) is a sulfonamide antibiotic (CHEBI:87228) |
| sulfamethizole (CHEBI:9331) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfaméthizol | ChEBI |
| sulfamethizole | ChemIDplus |
| sulfamethizolum | ChemIDplus |
| sulfametizol | ChemIDplus |
| Synonyms | Source |
|---|---|
| NSC-757327 | ChEMBL |
| Sulfamethizole | KEGG COMPOUND |
| sulfamethylthiadiazole | ChEBI |
| sulphamethazole | ChEBI |
| sulphamethiozole | ChEBI |
| Brand Names | Source |
|---|---|
| Methazol | ChEMBL |
| Microsul | ChEMBL |
| Proklar | ChEMBL |
| Rufol | DrugBank |
| Sulphamethylthiadiazole | ChEMBL |
| Tetracid | ChEMBL |
| Citations |
|---|