EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7Cl2N5 |
| Net Charge | 0 |
| Average Mass | 256.096 |
| Monoisotopic Mass | 255.00785 |
| SMILES | Nc1nc(N)nc(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C9H7Cl2N5/c10-4-1-2-6(11)5(3-4)7-14-8(12)16-9(13)15-7/h1-3H,(H4,12,13,14,15,16) |
| InChIKey | ATCGGEJZONJOCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine (CHEBI:93307) has role anti-ulcer drug (CHEBI:49201) |
| 6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine (CHEBI:93307) is a dichlorobenzene (CHEBI:23697) |
| INN | Source |
|---|---|
| irsogladina | WHO MedNet |
| Synonyms | Source |
|---|---|
| dicloguamine | DrugCentral |
| irsogladine | ChEMBL |
| Irsogladine | ChEMBL |
| irsogladine maleate | DrugCentral |
| NSC-759836 | ChEMBL |
| Citations |
|---|