EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O5S |
| Net Charge | 0 |
| Average Mass | 406.504 |
| Monoisotopic Mass | 406.15624 |
| SMILES | CC(C)ON([C@@H](C(=O)NO)C(C)C)S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-14(2)19(20(23)21-24)22(27-15(3)4)28(25,26)18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-15,19,24H,1-4H3,(H,21,23)/t19-/m1/s1 |
| InChIKey | DGZZVIWCMGVHGV-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 3.4.24.24 (gelatinase A) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase A (EC 3.4.24.24). |
| Applications: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-isopropoxy-D-valinamide (CHEBI:93296) has role antineoplastic agent (CHEBI:35610) |
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-isopropoxy-D-valinamide (CHEBI:93296) has role autophagy inducer (CHEBI:138880) |
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-isopropoxy-D-valinamide (CHEBI:93296) has role EC 3.4.24.24 (gelatinase A) inhibitor (CHEBI:84036) |
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-isopropoxy-D-valinamide (CHEBI:93296) has role melanin synthesis inhibitor (CHEBI:64933) |
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-isopropoxy-D-valinamide (CHEBI:93296) is a D-valine derivative (CHEBI:84130) |
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-isopropoxy-D-valinamide (CHEBI:93296) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Name |
|---|
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-isopropoxy-D-valinamide |
| Synonyms | Source |
|---|---|
| (2R)-2-[([1,1'-biphenyl]-4-ylsulfonyl)(1-methylethoxy)amino]-N-hydroxy-3-methyl-butanamide | ChEBI |
| (2R)-N-hydroxy-3-methyl-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]butanamide | LINCS |
| ARP 101 | ChEBI |
| ARP-101 | ChEBI |
| ARP101 | ChEBI |
| N2-([biphenyl]-4-ylsulfonyl)-N-hydroxy-N2-(propan-2-yloxy)-D-valinamide | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| LSM-3648 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9937045 | Reaxys |
| CAS:849773-64-4 | PubChem Compound |
| Citations |
|---|