EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9329 - sulfadoxine
| Formula | C12H14N4O4S |
| Net Charge | 0 |
| Average Mass | 310.335 |
| Monoisotopic Mass | 310.07358 |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(N)cc2)c1OC |
| InChI | InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | PJSFRIWCGOHTNF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfadoxine (CHEBI:9329) has role antibacterial drug (CHEBI:36047) |
| sulfadoxine (CHEBI:9329) has role antimalarial (CHEBI:38068) |
| sulfadoxine (CHEBI:9329) is a pyrimidines (CHEBI:39447) |
| sulfadoxine (CHEBI:9329) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfadoxine | KEGG DRUG |
| sulfadoxina | ChemIDplus |
| sulfadoxinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Sulfadoxine | KEGG COMPOUND |
| Sulforthomidine | ChemIDplus |
| Sulphadoxine | ChemIDplus |
| Sulphormethoxine | ChemIDplus |
| 4-Sulfanilamido-5,6-dimethoxypyrimidine | ChemIDplus |
| Citations |
|---|