EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9329 - sulfadoxine
| Formula | C12H14N4O4S |
| Net Charge | 0 |
| Average Mass | 310.335 |
| Monoisotopic Mass | 310.07358 |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(N)cc2)c1OC |
| InChI | InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | PJSFRIWCGOHTNF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfadoxine (CHEBI:9329) has role anti-anaemic agent (CHEBI:75835) |
| sulfadoxine (CHEBI:9329) has role anti-HIV agent (CHEBI:64946) |
| sulfadoxine (CHEBI:9329) has role antibacterial drug (CHEBI:36047) |
| sulfadoxine (CHEBI:9329) has role antifungal agent (CHEBI:35718) |
| sulfadoxine (CHEBI:9329) has role antimalarial (CHEBI:38068) |
| sulfadoxine (CHEBI:9329) is a pyrimidines (CHEBI:39447) |
| sulfadoxine (CHEBI:9329) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfadoxina | ChemIDplus |
| sulfadoxine | KEGG DRUG |
| sulfadoxinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Sulfanilamido-5,6-dimethoxypyrimidine | ChemIDplus |
| Fanasulf | ChEMBL |
| J21.373J | ChEMBL |
| NSC-759319 | ChEMBL |
| RO 4-4393 | ChEMBL |
| RO-4-4393 | ChEMBL |
| Brand Names | Source |
|---|---|
| Sulfadoxine component of fansidar | ChEMBL |
| Sulforthamidine | ChEMBL |
| Citations |
|---|