EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9329 - sulfadoxine
| Formula | C12H14N4O4S |
| Net Charge | 0 |
| Average Mass | 310.335 |
| Monoisotopic Mass | 310.07358 |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(N)cc2)c1OC |
| InChI | InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | PJSFRIWCGOHTNF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfadoxine (CHEBI:9329) has role antibacterial drug (CHEBI:36047) |
| sulfadoxine (CHEBI:9329) has role antimalarial (CHEBI:38068) |
| sulfadoxine (CHEBI:9329) is a pyrimidines (CHEBI:39447) |
| sulfadoxine (CHEBI:9329) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfadoxina | ChemIDplus |
| sulfadoxine | KEGG DRUG |
| sulfadoxinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Sulfanilamido-5,6-dimethoxypyrimidine | ChemIDplus |
| Sulfadoxine | KEGG COMPOUND |
| Sulforthomidine | ChemIDplus |
| Sulphadoxine | ChemIDplus |
| Sulphormethoxine | ChemIDplus |
| Citations |
|---|