EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O3S2 |
| Net Charge | 0 |
| Average Mass | 374.527 |
| Monoisotopic Mass | 374.10104 |
| SMILES | CCOC(=O)c1sc(SCc2ccccc2)c2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C20H22O3S2/c1-4-23-18(22)17-14-10-20(2,3)11-15(21)16(14)19(25-17)24-12-13-8-6-5-7-9-13/h5-9H,4,10-12H2,1-3H3 |
| InChIKey | XFYSUPHMJSFOLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,6-dimethyl-4-oxo-3-(phenylmethylthio)-5,7-dihydro-2-benzothiophene-1-carboxylic acid ethyl ester (CHEBI:93265) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3611 | LINCS |