Sulconazole nitrate (CHEBI:9326)

We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.

CHEBI:9326 - Sulconazole nitrate

Formula	C18H15Cl3N2S.HNO3
Net Charge	0
Average Mass	460.770
Monoisotopic Mass	458.99780
SMILES	Clc1ccc(CSC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1.O=[N+]([O-])O
InChI	InChI=1S/C18H15Cl3N2S.HNO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h1-9,12,18H,10-11H2;(H,2,3,4)
InChIKey	CRKGMGQUHDNAPB-UHFFFAOYSA-N

Roles Classification

antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce.

antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals.

antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce.

antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals.

antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce.

ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol.

antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce.

ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol.

antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals.

ChEBI Ontology

Outgoing Relation(s)
	Sulconazole nitrate (CHEBI:9326) has role antifungal agent (CHEBI:35718)
	Sulconazole nitrate (CHEBI:9326) is a conazole antifungal drug (CHEBI:87071)
	Sulconazole nitrate (CHEBI:9326) is a imidazole antifungal drug (CHEBI:87069)
	Sulconazole nitrate (CHEBI:9326) is a organic nitrate salt (CHEBI:51085)

Brand Names	Source
Exelderm	ChEMBL
Myk	ChEMBL

Manual Xrefs	Databases
D00886	KEGG DRUG

Registry Numbers	Sources
CAS:61318-91-0	KEGG COMPOUND

Citations