EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15Cl3N2S.HNO3 |
| Net Charge | 0 |
| Average Mass | 460.770 |
| Monoisotopic Mass | 458.99780 |
| SMILES | Clc1ccc(CSC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C18H15Cl3N2S.HNO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h1-9,12,18H,10-11H2;(H,2,3,4) |
| InChIKey | CRKGMGQUHDNAPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sulconazole nitrate (CHEBI:9326) has role antifungal agent (CHEBI:35718) |
| Sulconazole nitrate (CHEBI:9326) is a conazole antifungal drug (CHEBI:87071) |
| Sulconazole nitrate (CHEBI:9326) is a imidazole antifungal drug (CHEBI:87069) |
| Sulconazole nitrate (CHEBI:9326) is a organic nitrate salt (CHEBI:51085) |
| Synonyms | Source |
|---|---|
| NSC-757849 | ChEMBL |
| RS-44872 | ChEMBL |
| RS-44872-00-10-3 | ChEMBL |
| RS-44872-00-1O-3 | ChEMBL |
| Sulconazole nitrate | KEGG COMPOUND |
| Sulcosyn | ChEMBL |
| Brand Names | Source |
|---|---|
| Exelderm | ChEMBL |
| Myk | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00886 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:61318-91-0 | KEGG COMPOUND |
| Citations |
|---|