EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19ClFN7 |
| Net Charge | 0 |
| Average Mass | 387.850 |
| Monoisotopic Mass | 387.13745 |
| SMILES | CN1CCC(Nc2ncc3ncnc(Nc4ccc(F)c(Cl)c4)c3n2)CC1 |
| InChI | InChI=1S/C18H19ClFN7/c1-27-6-4-11(5-7-27)25-18-21-9-15-16(26-18)17(23-10-22-15)24-12-2-3-14(20)13(19)8-12/h2-3,8-11H,4-7H2,1H3,(H,21,25,26)(H,22,23,24) |
| InChIKey | FTFRZXFNZVCRSK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N4-(3-chloro-4-fluorophenyl)-N6-(1-methyl-4-piperidinyl)pyrimido[5,4-d]pyrimidine-4,6-diamine (CHEBI:93243) has role antineoplastic agent (CHEBI:35610) |
| N4-(3-chloro-4-fluorophenyl)-N6-(1-methyl-4-piperidinyl)pyrimido[5,4-d]pyrimidine-4,6-diamine (CHEBI:93243) is a substituted aniline (CHEBI:48975) |
| INN | Source |
|---|---|
| falnidamol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bibx1382 | ChEMBL |
| BIBX 1382 | ChEMBL |
| BIBX-1382 | ChEMBL |
| falnidamol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-3584 | LINCS |
| Citations |
|---|