EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O2S |
| Net Charge | 0 |
| Average Mass | 386.561 |
| Monoisotopic Mass | 386.20280 |
| SMILES | CCC(=O)N(c1ccccc1)C1(COC)CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C22H30N2O2S/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20/h4-10,17H,3,11-16,18H2,1-2H3 |
| InChIKey | GGCSSNBKKAUURC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sufentanil (CHEBI:9316) has role anaesthesia adjuvant (CHEBI:60807) |
| sufentanil (CHEBI:9316) has role intravenous anaesthetic (CHEBI:38877) |
| sufentanil (CHEBI:9316) has role opioid analgesic (CHEBI:35482) |
| sufentanil (CHEBI:9316) has role μ-opioid receptor agonist (CHEBI:55322) |
| sufentanil (CHEBI:9316) is a anilide (CHEBI:13248) |
| sufentanil (CHEBI:9316) is a ether (CHEBI:25698) |
| sufentanil (CHEBI:9316) is a piperidines (CHEBI:26151) |
| sufentanil (CHEBI:9316) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N-{4-(methoxymethyl)-1-[2-(2-thienyl)ethyl]piperidin-4-yl}-N-phenylpropanamide |
| INNs | Source |
|---|---|
| sufentanil | KEGG DRUG |
| sufentanilum | DrugBank |
| Synonyms | Source |
|---|---|
| Sufentanyl | DrugBank |
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidinyl)-N-phenylpropanamide | ChemIDplus |
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidyl)propionanilide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08022 | KEGG COMPOUND |
| D05938 | KEGG DRUG |
| DB00708 | DrugBank |
| DE2610228 | Patent |
| US3998834 | Patent |
| Sufentanil | Wikipedia |
| HMDB0014846 | HMDB |
| 2491 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:499558 | Reaxys |
| CAS:56030-54-7 | KEGG COMPOUND |
| CAS:56030-54-7 | ChemIDplus |
| Citations |
|---|