EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O2S |
| Net Charge | 0 |
| Average Mass | 386.561 |
| Monoisotopic Mass | 386.20280 |
| SMILES | CCC(=O)N(c1ccccc1)C1(COC)CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C22H30N2O2S/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20/h4-10,17H,3,11-16,18H2,1-2H3 |
| InChIKey | GGCSSNBKKAUURC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sufentanil (CHEBI:9316) has role anaesthesia adjuvant (CHEBI:60807) |
| sufentanil (CHEBI:9316) has role intravenous anaesthetic (CHEBI:38877) |
| sufentanil (CHEBI:9316) has role opioid analgesic (CHEBI:35482) |
| sufentanil (CHEBI:9316) has role μ-opioid receptor agonist (CHEBI:55322) |
| sufentanil (CHEBI:9316) is a anilide (CHEBI:13248) |
| sufentanil (CHEBI:9316) is a ether (CHEBI:25698) |
| sufentanil (CHEBI:9316) is a piperidines (CHEBI:26151) |
| sufentanil (CHEBI:9316) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N-{4-(methoxymethyl)-1-[2-(2-thienyl)ethyl]piperidin-4-yl}-N-phenylpropanamide |
| INNs | Source |
|---|---|
| sufentanil | KEGG DRUG |
| sufentanilum | DrugBank |
| Synonyms | Source |
|---|---|
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidinyl)-N-phenylpropanamide | ChemIDplus |
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidyl)propionanilide | ChemIDplus |
| Sufentanyl | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2491 | DrugCentral |
| C08022 | KEGG COMPOUND |
| D05938 | KEGG DRUG |
| DB00708 | DrugBank |
| DE2610228 | Patent |
| HMDB0014846 | HMDB |
| Sufentanil | Wikipedia |
| US3998834 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:499558 | Reaxys |
| CAS:56030-54-7 | ChemIDplus |
| CAS:56030-54-7 | KEGG COMPOUND |
| Citations |
|---|