EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9316 - sufentanil
| Formula | C22H30N2O2S |
| Net Charge | 0 |
| Average Mass | 386.561 |
| Monoisotopic Mass | 386.20280 |
| SMILES | CCC(=O)N(c1ccccc1)C1(COC)CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C22H30N2O2S/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20/h4-10,17H,3,11-16,18H2,1-2H3 |
| InChIKey | GGCSSNBKKAUURC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. vulnerary A drug used in treating and healing of wounds. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sufentanil (CHEBI:9316) has role anaesthesia adjuvant (CHEBI:60807) |
| sufentanil (CHEBI:9316) has role analgesic (CHEBI:35480) |
| sufentanil (CHEBI:9316) has role anti-inflammatory agent (CHEBI:67079) |
| sufentanil (CHEBI:9316) has role intravenous anaesthetic (CHEBI:38877) |
| sufentanil (CHEBI:9316) has role opioid analgesic (CHEBI:35482) |
| sufentanil (CHEBI:9316) has role vulnerary (CHEBI:73336) |
| sufentanil (CHEBI:9316) has role μ-opioid receptor agonist (CHEBI:55322) |
| sufentanil (CHEBI:9316) is a anilide (CHEBI:13248) |
| sufentanil (CHEBI:9316) is a ether (CHEBI:25698) |
| sufentanil (CHEBI:9316) is a piperidines (CHEBI:26151) |
| sufentanil (CHEBI:9316) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N-{4-(methoxymethyl)-1-[2-(2-thienyl)ethyl]piperidin-4-yl}-N-phenylpropanamide |
| INNs | Source |
|---|---|
| sufentanil | KEGG DRUG |
| sufentanilo | WHO MedNet |
| sufentanilum | DrugBank |
| Synonyms | Source |
|---|---|
| IDS-NS-001 | ChEMBL |
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidinyl)-N-phenylpropanamide | ChemIDplus |
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidyl)propionanilide | ChemIDplus |
| R 30,730 | ChEMBL |
| R-30730 | ChEMBL |
| Sufentanyl | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2491 | DrugCentral |
| C08022 | KEGG COMPOUND |
| D05938 | KEGG DRUG |
| DB00708 | DrugBank |
| DE2610228 | Patent |
| HMDB0014846 | HMDB |
| Sufentanil | Wikipedia |
| US3998834 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:499558 | Reaxys |
| CAS:56030-54-7 | KEGG COMPOUND |
| CAS:56030-54-7 | ChemIDplus |
| Citations |
|---|