EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9316 - sufentanil
| Formula | C22H30N2O2S |
| Net Charge | 0 |
| Average Mass | 386.561 |
| Monoisotopic Mass | 386.20280 |
| SMILES | CCC(=O)N(c1ccccc1)C1(COC)CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C22H30N2O2S/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20/h4-10,17H,3,11-16,18H2,1-2H3 |
| InChIKey | GGCSSNBKKAUURC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. anti-inflammatory agent Any compound that has anti-inflammatory effects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. vulnerary A drug used in treating and healing of wounds. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sufentanil (CHEBI:9316) has role anaesthesia adjuvant (CHEBI:60807) |
| sufentanil (CHEBI:9316) has role analgesic (CHEBI:35480) |
| sufentanil (CHEBI:9316) has role anti-inflammatory agent (CHEBI:67079) |
| sufentanil (CHEBI:9316) has role intravenous anaesthetic (CHEBI:38877) |
| sufentanil (CHEBI:9316) has role opioid analgesic (CHEBI:35482) |
| sufentanil (CHEBI:9316) has role vulnerary (CHEBI:73336) |
| sufentanil (CHEBI:9316) has role μ-opioid receptor agonist (CHEBI:55322) |
| sufentanil (CHEBI:9316) is a anilide (CHEBI:13248) |
| sufentanil (CHEBI:9316) is a ether (CHEBI:25698) |
| sufentanil (CHEBI:9316) is a piperidines (CHEBI:26151) |
| sufentanil (CHEBI:9316) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N-{4-(methoxymethyl)-1-[2-(2-thienyl)ethyl]piperidin-4-yl}-N-phenylpropanamide |
| INNs | Source |
|---|---|
| sufentanil | KEGG DRUG |
| sufentanilo | WHO MedNet |
| sufentanilum | DrugBank |
| Synonyms | Source |
|---|---|
| IDS-NS-001 | ChEMBL |
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidinyl)-N-phenylpropanamide | ChemIDplus |
| N-(4-(Methoxymethyl)-1-(2-(2-thienyl)ethyl)-4-piperidyl)propionanilide | ChemIDplus |
| R 30,730 | ChEMBL |
| R-30730 | ChEMBL |
| Sufentanyl | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2491 | DrugCentral |
| C08022 | KEGG COMPOUND |
| D05938 | KEGG DRUG |
| DB00708 | DrugBank |
| DE2610228 | Patent |
| HMDB0014846 | HMDB |
| Sufentanil | Wikipedia |
| US3998834 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:499558 | Reaxys |
| CAS:56030-54-7 | KEGG COMPOUND |
| CAS:56030-54-7 | ChemIDplus |
| Citations |
|---|