EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:93130 - 1-methyl-3-[3-methyl-4-[4-(trifluoromethylthio)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione
| Formula | C18H14F3N3O4S |
| Net Charge | 0 |
| Average Mass | 425.388 |
| Monoisotopic Mass | 425.06571 |
| SMILES | Cc1cc(-n2c(=O)nc(=O)n(C)c2=O)ccc1Oc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3N3O4S/c1-10-9-11(24-16(26)22-15(25)23(2)17(24)27)3-8-14(10)28-12-4-6-13(7-5-12)29-18(19,20)21/h3-9H,1-2H3,(H,22,25,26) |
| InChIKey | OCINXEZVIIVXFU-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyl-3-[3-methyl-4-[4-(trifluoromethylthio)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione (CHEBI:93130) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| toltrazurilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY VI 9142 | ChEMBL |
| BAY-VI-9142 | ChEMBL |
| NSC-759176 | ChEMBL |
| toltrazuril | ChEMBL |
| Toltrazuril | ChEMBL |
| Brand Name | Source |
|---|---|
| Toltrazuril component of procox | ChEMBL |
| Citations |
|---|