EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H35F2N3O |
| Net Charge | 0 |
| Average Mass | 491.626 |
| Monoisotopic Mass | 491.27482 |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H35F2N3O/c1-22-5-3-6-23(2)30(22)33-29(36)21-35-19-17-34(18-20-35)16-4-7-28(24-8-12-26(31)13-9-24)25-10-14-27(32)15-11-25/h3,5-6,8-15,28H,4,7,16-21H2,1-2H3,(H,33,36) |
| InChIKey | ZBIAKUMOEKILTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[4-[4,4-bis(4-fluorophenyl)butyl]-1-piperazinyl]-N-(2,6-dimethylphenyl)acetamide (CHEBI:93095) has role cardiovascular drug (CHEBI:35554) |
| 2-[4-[4,4-bis(4-fluorophenyl)butyl]-1-piperazinyl]-N-(2,6-dimethylphenyl)acetamide (CHEBI:93095) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| lidoflazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| corflazine | DrugCentral |
| lidoflazin | DrugCentral |
| lidoflazine | ChEMBL |
| Lidoflazine | ChEMBL |
| lidoflazinum | DrugCentral |
| MCN-JR-7904 | ChEMBL |
| Brand Names | Source |
|---|---|
| Angex | ChEMBL |
| Clinium | ChEMBL |
| Citations |
|---|