EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13NO2S |
| Net Charge | 0 |
| Average Mass | 259.330 |
| Monoisotopic Mass | 259.06670 |
| SMILES | O=C(O)c1cccnc1SCCc1ccccc1 |
| InChI | InChI=1S/C14H13NO2S/c16-14(17)12-7-4-9-15-13(12)18-10-8-11-5-2-1-3-6-11/h1-7,9H,8,10H2,(H,16,17) |
| InChIKey | UZERZZRWECLIKE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-phenylethylthio)-3-pyridinecarboxylic acid (CHEBI:93083) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-(2-phenylethylthio)-3-pyridinecarboxylic acid (CHEBI:93083) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3378 | LINCS |