EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10BrN3O4 |
| Net Charge | 0 |
| Average Mass | 352.144 |
| Monoisotopic Mass | 350.98547 |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)Nc1ccccc1Br |
| InChI | InChI=1S/C13H10BrN3O4/c14-9-3-1-2-4-10(9)15-13(19)16-11-6-5-8(17(20)21)7-12(11)18/h1-7,18H,(H2,15,16,19) |
| InChIKey | MQBZVUNNWUIPMK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antinociceptive agent Any agent that inhibits nociception. CXCR2 antagonist An antagonist that blocks CXCR2. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antinociceptive agent Any agent that inhibits nociception. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB225002 (CHEBI:93074) has role anti-inflammatory agent (CHEBI:67079) |
| SB225002 (CHEBI:93074) has role antineoplastic agent (CHEBI:35610) |
| SB225002 (CHEBI:93074) has role antinociceptive agent (CHEBI:228138) |
| SB225002 (CHEBI:93074) has role apoptosis inducer (CHEBI:68495) |
| SB225002 (CHEBI:93074) has role CXCR2 antagonist (CHEBI:231732) |
| SB225002 (CHEBI:93074) is a bromobenzenes (CHEBI:37149) |
| SB225002 (CHEBI:93074) is a nitrophenol (CHEBI:25562) |
| SB225002 (CHEBI:93074) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 1-(2-bromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea |
| Synonyms | Source |
|---|---|
| N-(2-hydroxy-4-nitrophenyl)-N'-(2-bromophenyl)urea | ChEBI |
| PD 157695 | ChEBI |
| PD-157695 | ChEBI |
| PD157695 | ChEBI |
| SB 225002 | ChEBI |
| SB-225002 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-3367 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10689013 | Reaxys |
| CAS:182498-32-4 | ChEBI |
| Citations |
|---|