EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19N5O3S |
| Net Charge | 0 |
| Average Mass | 433.493 |
| Monoisotopic Mass | 433.12086 |
| SMILES | O=C(O)c1ccc(-c2cccc(-c3nn4c(=O)cc(N5CCNCC5)nc4s3)c2)cc1 |
| InChI | InChI=1S/C22H19N5O3S/c28-19-13-18(26-10-8-23-9-11-26)24-22-27(19)25-20(31-22)17-3-1-2-16(12-17)14-4-6-15(7-5-14)21(29)30/h1-7,12-13,23H,8-11H2,(H,29,30) |
| InChIKey | IPUKQDAXCONVQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[3-[5-oxo-7-(1-piperazinyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-2-yl]phenyl]benzoic acid (CHEBI:93001) is a biphenyls (CHEBI:22888) |
| 4-[3-[5-oxo-7-(1-piperazinyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-2-yl]phenyl]benzoic acid (CHEBI:93001) is a carboxybiphenyl (CHEBI:141493) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3269 | LINCS |