EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O3 |
| Net Charge | 0 |
| Average Mass | 264.325 |
| Monoisotopic Mass | 264.14739 |
| SMILES | COc1cc(/C=C/C(=O)NCCCCN)ccc1O |
| InChI | InChI=1S/C14H20N2O3/c1-19-13-10-11(4-6-12(13)17)5-7-14(18)16-9-3-2-8-15/h4-7,10,17H,2-3,8-9,15H2,1H3,(H,16,18)/b7-5+ |
| InChIKey | SFUVCMKSYKHYLD-FNORWQNLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Subaphyllin (CHEBI:9299) is a hydroxycinnamic acid (CHEBI:24689) |
| Synonyms | Source |
|---|---|
| Subaphyllin | KEGG COMPOUND |
| Feruloylputrescine | KEGG COMPOUND |
| Subaphyllin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10497 | KEGG COMPOUND |
| C00002780 | KNApSAcK |
| HMDB0139553 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:501-13-3 | KEGG COMPOUND |