EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N3 |
| Net Charge | 0 |
| Average Mass | 319.452 |
| Monoisotopic Mass | 319.20485 |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(C)nc2)CCN(C)C1 |
| InChI | InChI=1S/C21H25N3/c1-15-4-7-20-18(12-15)19-14-23(3)10-9-21(19)24(20)11-8-17-6-5-16(2)22-13-17/h4-7,12-13H,8-11,14H2,1-3H3 |
| InChIKey | JNODQFNWMXFMEV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| latrepirdine (CHEBI:92976) has role geroprotector (CHEBI:176497) |
| latrepirdine (CHEBI:92976) is a methylpyridines (CHEBI:25340) |
| latrepirdine (CHEBI:92976) is a pyridoindole (CHEBI:48888) |
| Synonyms | Source |
|---|---|
| dimebolin | ChemIDplus |
| dimebon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-3241 | LINCS |
| HMDB0240240 | HMDB |
| 170644 | ChemSpider |
| DB11725 | DrugBank |
| Latrepirdine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:3613-73-8 | ChemIDplus |
| Citations |
|---|