EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | Cc1c(O)cc2c(c1O)C(=O)C[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C16H14O4/c1-9-11(17)7-14-15(16(9)19)12(18)8-13(20-14)10-5-3-2-4-6-10/h2-7,13,17,19H,8H2,1H3/t13-/m0/s1 |
| InChIKey | INBPQAJYHSJVRY-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus strobus (ncbitaxon:3348) | heartwood (PO:0004512) | PubMed (13465274) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strobopinin (CHEBI:9292) has functional parent (2S)-flavanone (CHEBI:15606) |
| strobopinin (CHEBI:9292) has role plant metabolite (CHEBI:76924) |
| strobopinin (CHEBI:9292) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-6-methyl-2-phenyl-2,3-dihydro-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| C09939 | KEGG COMPOUND |
| C00001006 | KNApSAcK |
| LMPK12140187 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90361 | Reaxys |
| CAS:491-66-7 | KEGG COMPOUND |
| Citations |
|---|