EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | [H][C@]12OC(=O)/C(=C/O[C@H]3C=C(C)C(=O)O3)[C@@]1([H])CC1=C2C(C)(C)CC[C@@H]1O |
| InChI | InChI=1S/C19H22O6/c1-9-6-14(24-17(9)21)23-8-12-10-7-11-13(20)4-5-19(2,3)15(11)16(10)25-18(12)22/h6,8,10,13-14,16,20H,4-5,7H2,1-3H3/b12-8+/t10-,13+,14-,16+/m1/s1 |
| InChIKey | VOFXXOPWCBSPAA-KCNJUGRMSA-N |
| Roles Classification |
|---|
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strigol (CHEBI:9290) is a indenofuran (CHEBI:149453) |
| strigol (CHEBI:9290) is a secondary alcohol (CHEBI:35681) |
| strigol (CHEBI:9290) is a strigolactone (CHEBI:68487) |
| IUPAC Name |
|---|
| (3E,3aR,5S,8bS)-5-hydroxy-8,8-dimethyl-3-({[(2R)-4-methyl-5-oxo-2,5-dihydrofuran-2-yl]oxy}methylene)-3,3a,4,5,6,7,8,8b-octahydro-2H-indeno[1,2-b]furan-2-one |
| Synonyms | Source |
|---|---|
| Strigol | KEGG COMPOUND |
| (+)-strigol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C09190 | KEGG COMPOUND |
| US2008318773 | Patent |
| C00003486 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1299462 | Reaxys |
| CAS:11017-56-4 | KEGG COMPOUND |
| CAS:11017-56-4 | ChemIDplus |
| Citations |
|---|