EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8N2O3 |
| Net Charge | 0 |
| Average Mass | 204.185 |
| Monoisotopic Mass | 204.05349 |
| SMILES | N#CC(=Cc1ccc(O)c(O)c1)C(N)=O |
| InChI | InChI=1S/C10H8N2O3/c11-5-7(10(12)15)3-6-1-2-8(13)9(14)4-6/h1-4,13-14H,(H2,12,15) |
| InChIKey | USOXQZNJFMKTKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyano-3-(3,4-dihydroxyphenyl)-2-propenamide (CHEBI:92889) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-3130 | LINCS |