EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8ClNS |
| Net Charge | 0 |
| Average Mass | 161.657 |
| Monoisotopic Mass | 161.00660 |
| SMILES | Cc1ncsc1CCCl |
| InChI | InChI=1S/C6H8ClNS/c1-5-6(2-3-7)9-4-8-5/h4H,2-3H2,1H3 |
| InChIKey | PCLITLDOTJTVDJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(2-chloroethyl)-4-methylthiazole (CHEBI:92875) has role antidepressant (CHEBI:35469) |
| 5-(2-chloroethyl)-4-methylthiazole (CHEBI:92875) has role antipsychotic agent (CHEBI:35476) |
| 5-(2-chloroethyl)-4-methylthiazole (CHEBI:92875) has role anxiolytic drug (CHEBI:35474) |
| 5-(2-chloroethyl)-4-methylthiazole (CHEBI:92875) is a thiazoles (CHEBI:48901) |
| INN | Source |
|---|---|
| clometiazol | WHO MedNet |
| Synonyms | Source |
|---|---|
| chlorethiazol | DrugCentral |
| chlorethiazole | DrugCentral |
| chlormethiazol | DrugCentral |
| chlormethiazole | DrugCentral |
| chlormethiazole HCl | DrugCentral |
| chlormethiazole hydrochloride | DrugCentral |
| Brand Name | Source |
|---|---|
| Heminevrin | ChEMBL |
| Citations |
|---|