EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22N4O8 |
| Net Charge | 0 |
| Average Mass | 506.471 |
| Monoisotopic Mass | 506.14376 |
| SMILES | COC1=C(N)C(=O)c2nc(-c3nc(C(=O)O)c(C)c(-c4ccc(OC)c(OC)c4O)c3N)ccc2C1=O |
| InChI | InChI=1S/C25H22N4O8/c1-9-14(10-6-8-13(35-2)23(36-3)20(10)30)15(26)19(29-17(9)25(33)34)12-7-5-11-18(28-12)22(32)16(27)24(37-4)21(11)31/h5-8,30H,26-27H2,1-4H3,(H,33,34) |
| InChIKey | PVYJZLYGTZKPJE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptonigrin (CHEBI:9287) has role antimicrobial agent (CHEBI:33281) |
| streptonigrin (CHEBI:9287) has role antineoplastic agent (CHEBI:35610) |
| streptonigrin (CHEBI:9287) is a pyridines (CHEBI:26421) |
| streptonigrin (CHEBI:9287) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 5-amino-6-(7-amino-6-methoxy-5,8-dioxo-5,8-dihydroquinolin-2-yl)-4-(2-hydroxy-3,4-dimethoxyphenyl)-3-methylpyridine-2-carboxylic acid |
| INNs | Source |
|---|---|
| rufocromomycin | KEGG DRUG |
| rufocromomicina | ChemIDplus |
| rufocromomycinum | ChemIDplus |
| rufocromomycine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Amino-6-(7-amino-5,8-dihydro-6-methoxy-5,8-dioxo-2-quinolyl)-4-(2-hydroxy-3,4-dimethoxyphenyl)-3-methylpicolinic acid | ChemIDplus |
| Streptonigran | ChemIDplus |
| Citations |
|---|