EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12BrN5 |
| Net Charge | 0 |
| Average Mass | 330.189 |
| Monoisotopic Mass | 329.02761 |
| SMILES | CNc1cc2c(Nc3cccc(Br)c3)ncnc2cn1 |
| InChI | InChI=1S/C14H12BrN5/c1-16-13-6-11-12(7-17-13)18-8-19-14(11)20-10-4-2-3-9(15)5-10/h2-8H,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | KFHMLBXBRCITHF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD158780 (CHEBI:92843) has role antineoplastic agent (CHEBI:35610) |
| PD158780 (CHEBI:92843) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| PD158780 (CHEBI:92843) is a aromatic amine (CHEBI:33860) |
| PD158780 (CHEBI:92843) is a bromobenzenes (CHEBI:37149) |
| PD158780 (CHEBI:92843) is a diamine (CHEBI:23666) |
| PD158780 (CHEBI:92843) is a pyridopyrimidine (CHEBI:38932) |
| PD158780 (CHEBI:92843) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N4-(3-bromophenyl)-N6-methylpyrido[3,4-d]pyrimidine-4,6-diamine |
| Synonyms | Source |
|---|---|
| 4-(3-bromoanilino)-6-methylaminopyrido[3,4-d]pyrimidine | ChEBI |
| 4-(3-bromoanilino)-6-(methylamino)pyrido[3,4-d]pyrimidine | ChEBI |
| 4-[(3-bromophenyl)amino]-6-(methylamino)pyrido[3,4-d]pyrimidine | ChEBI |
| PD 158780 | ChEBI |
| PD-158780 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-3069 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7487408 | Reaxys |
| CAS:171179-06-9 | ChemIDplus |
| CAS:171179-06-9 | LINCS |
| Citations |
|---|