EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H23NO9 |
| Net Charge | 0 |
| Average Mass | 337.325 |
| Monoisotopic Mass | 337.13728 |
| SMILES | [H]C(=O)[C@@](O)([C@H](C)O)[C@H](C=O)O[C@@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1NC |
| InChI | InChI=1S/C13H23NO9/c1-6(18)13(21,5-17)8(4-16)23-12-9(14-2)11(20)10(19)7(3-15)22-12/h4-12,14-15,18-21H,3H2,1-2H3/t6-,7-,8-,9-,10-,11-,12-,13+/m0/s1 |
| InChIKey | UNTJYOFZBHSHIU-HXYRURAXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptobiosamine (CHEBI:9283) has role metabolite (CHEBI:25212) |
| streptobiosamine (CHEBI:9283) is a amino disaccharide (CHEBI:22480) |
| IUPAC Name |
|---|
| 5-deoxy-2-O-[2-deoxy-2-(methylamino)-α-L-glucopyranosyl]-3-C-formyl-L-lyxose |