EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2O |
| Net Charge | 0 |
| Average Mass | 184.198 |
| Monoisotopic Mass | 184.06366 |
| SMILES | COc1ccc(C=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C11H8N2O/c1-14-11-4-2-9(3-5-11)6-10(7-12)8-13/h2-6H,1H3 |
| InChIKey | UOHFCPXBKJPCAD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrphostin 1 (CHEBI:92740) has role geroprotector (CHEBI:176497) |
| tyrphostin 1 (CHEBI:92740) is a methoxybenzenes (CHEBI:51683) |
| Citations |
|---|