EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO6 |
| Net Charge | 0 |
| Average Mass | 227.172 |
| Monoisotopic Mass | 227.04299 |
| SMILES | NC(Cc1cc(C(=O)O)oc(=O)c1)C(=O)O |
| InChI | InChI=1S/C9H9NO6/c10-5(8(12)13)1-4-2-6(9(14)15)16-7(11)3-4/h2-3,5H,1,10H2,(H,12,13)(H,14,15) |
| InChIKey | KQZBVNZAEQASKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stizolobate (CHEBI:9274) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Stizolobate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06047 | KEGG COMPOUND |