EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:92658 - kenpaullone
| Formula | C16H11BrN2O |
| Net Charge | 0 |
| Average Mass | 327.181 |
| Monoisotopic Mass | 326.00548 |
| SMILES | O=C1Cc2c(nc3ccc(Br)cc23)-c2ccccc2N1 |
| InChI | InChI=1S/C16H11BrN2O/c17-9-5-6-14-11(7-9)12-8-15(20)18-13-4-2-1-3-10(13)16(12)19-14/h1-7,19H,8H2,(H,18,20) |
| InChIKey | QQUXFYAWXPMDOE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kenpaullone (CHEBI:92658) has functional parent paullone (CHEBI:138487) |
| kenpaullone (CHEBI:92658) has role cardioprotective agent (CHEBI:77307) |
| kenpaullone (CHEBI:92658) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| kenpaullone (CHEBI:92658) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| kenpaullone (CHEBI:92658) has role geroprotector (CHEBI:176497) |
| kenpaullone (CHEBI:92658) is a indolobenzazepine (CHEBI:138606) |
| kenpaullone (CHEBI:92658) is a lactam (CHEBI:24995) |
| kenpaullone (CHEBI:92658) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| 9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6(5H)-one |
| Synonym | Source |
|---|---|
| 9-bromopaullone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5346108 | Reaxys |
| CAS:142273-20-9 | ChemIDplus |
| Citations |
|---|